About 1-hydroxyethoxy methyl carbonate
1-hydroxyethoxy methyl carbonate (PubChem CID 175191129) has the molecular formula C4H8O5
and a molecular weight of 136.10 g/mol. Its IUPAC name is 1-hydroxyethoxy methyl carbonate.
Molecular Properties
| Compound Name | 1-hydroxyethoxy methyl carbonate |
| PubChem CID | 175191129 |
| Molecular Formula | C4H8O5 |
| Molecular Weight | 136.10 g/mol |
| Exact Mass | 136.04 |
| IUPAC Name | 1-hydroxyethoxy methyl carbonate |
| SMILES | COC(=O)OOC(C)O |
| InChI | InChI=1S/C4H8O5/c1-3(5)8-9-4(6)7-2/h3,5H,1-2H3 |
| InChIKey | GJNXWFGMCHXHGA-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.10 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxyethoxy methyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxyethoxy methyl carbonate?
The IUPAC name of 1-hydroxyethoxy methyl carbonate (CID 175191129) is 1-hydroxyethoxy methyl carbonate.
What is the SMILES notation for 1-hydroxyethoxy methyl carbonate?
The canonical SMILES for 1-hydroxyethoxy methyl carbonate is COC(=O)OOC(C)O.
What is the InChIKey of 1-hydroxyethoxy methyl carbonate?
The InChIKey is GJNXWFGMCHXHGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O5/c1-3(5)8-9-4(6)7-2/h3,5H,1-2H3.
What are the key properties of 1-hydroxyethoxy methyl carbonate?
1-hydroxyethoxy methyl carbonate has a molecular weight of 136.10 g/mol, XLogP of 0.04, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxyethoxy methyl carbonate is sourced from PubChem (CID 175191129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).