C8H6O4 — CID 175192341
(6R,7S)-4,10-dioxatricyclo[5.2.1.02,6]dec-1-ene-3,5-dione (PubChem CID 175192341) has the molecular formula C8H6O4 and a molecular weight of 166.13 g/mol. Its IUPAC name is (6R,7S)-4,10-dioxatricyclo[5.2.1.02,6]dec-1-ene-3,5-dione.
| Compound Name | (6R,7S)-4,10-dioxatricyclo[5.2.1.02,6]dec-1-ene-3,5-dione |
|---|---|
| PubChem CID | 175192341 |
| Molecular Formula | C8H6O4 |
| Molecular Weight | 166.13 g/mol |
| Exact Mass | 166.03 |
| IUPAC Name | (6R,7S)-4,10-dioxatricyclo[5.2.1.02,6]dec-1-ene-3,5-dione |
| SMILES | O=C1OC(=O)[C@@H]2C1=C1CC[C@@H]2O1 |
| InChI | InChI=1S/C8H6O4/c9-7-5-3-1-2-4(11-3)6(5)8(10)12-7/h3,5H,1-2H2/t3-,5-/m0/s1 |
| InChIKey | TUFPWGDTUYHGBL-UCORVYFPSA-N |
| XLogP | 0.13 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.13 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|