C34H45F2NO5Si — CID 175193653
tert-butyl (2R,5R)-5-[6-[tert-butyl(diphenyl)silyl]oxy-2,2-difluoro-4-methylidenehexanoyl]-2-methyl-4-oxopiperidine-1-carboxylate (PubChem CID 175193653) has the molecular formula C34H45F2NO5Si and a molecular weight of 613.82 g/mol. Its IUPAC name is tert-butyl (2R,5R)-5-[6-[tert-butyl(diphenyl)silyl]oxy-2,2-difluoro-4-methylidenehexanoyl]-2-methyl-4-oxopiperidine-1-carboxylate.
| Compound Name | tert-butyl (2R,5R)-5-[6-[tert-butyl(diphenyl)silyl]oxy-2,2-difluoro-4-methylidenehexanoyl]-2-methyl-4-oxopiperidine-1-carboxylate |
|---|---|
| PubChem CID | 175193653 |
| Molecular Formula | C34H45F2NO5Si |
| Molecular Weight | 613.82 g/mol |
| Exact Mass | 613.30 |
| IUPAC Name | tert-butyl (2R,5R)-5-[6-[tert-butyl(diphenyl)silyl]oxy-2,2-difluoro-4-methylidenehexanoyl]-2-methyl-4-oxopiperidine-1-carboxylate |
| SMILES | C=C(CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)CC(F)(F)C(=O)[C@@H]1CN(C(=O)OC(C)(C)C)[C@H](C)CC1=O |
| InChI | InChI=1S/C34H45F2NO5Si/c1-24(19-20-41-43(33(6,7)8,26-15-11-9-12-16-26)27-17-13-10-14-18-27)22-34(35,36)30(39)28-23-37(25(2)21-29(28)38)31(40)42-32(3,4)5/h9-18,25,28H,1,19-23H2,2-8H3/t25-,28-/m1/s1 |
| InChIKey | FMGPWPLVJICQLM-LEAFIULHSA-N |
| XLogP | 6.32 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.82 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|