About boric acid;2-[2-hydroxyethyl-[2-(4-methylphenyl)ethenyl]amino]ethanol
boric acid;2-[2-hydroxyethyl-[2-(4-methylphenyl)ethenyl]amino]ethanol (PubChem CID 175194087) has the molecular formula C13H22BNO5
and a molecular weight of 283.13 g/mol. Its IUPAC name is boric acid;2-[2-hydroxyethyl-[2-(4-methylphenyl)ethenyl]amino]ethanol.
Molecular Properties
| Compound Name | boric acid;2-[2-hydroxyethyl-[2-(4-methylphenyl)ethenyl]amino]ethanol |
| PubChem CID | 175194087 |
| Molecular Formula | C13H22BNO5 |
| Molecular Weight | 283.13 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | boric acid;2-[2-hydroxyethyl-[2-(4-methylphenyl)ethenyl]amino]ethanol |
| SMILES | Cc1ccc(C=CN(CCO)CCO)cc1.OB(O)O |
| InChI | InChI=1S/C13H19NO2.BH3O3/c1-12-2-4-13(5-3-12)6-7-14(8-10-15)9-11-16;2-1(3)4/h2-7,15-16H,8-11H2,1H3;2-4H |
| InChIKey | KMZXZDVKQUCANJ-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 104.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.13 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze boric acid;2-[2-hydroxyethyl-[2-(4-methylphenyl)ethenyl]amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of boric acid;2-[2-hydroxyethyl-[2-(4-methylphenyl)ethenyl]amino]ethanol?
The IUPAC name of boric acid;2-[2-hydroxyethyl-[2-(4-methylphenyl)ethenyl]amino]ethanol (CID 175194087) is boric acid;2-[2-hydroxyethyl-[2-(4-methylphenyl)ethenyl]amino]ethanol.
What is the SMILES notation for boric acid;2-[2-hydroxyethyl-[2-(4-methylphenyl)ethenyl]amino]ethanol?
The canonical SMILES for boric acid;2-[2-hydroxyethyl-[2-(4-methylphenyl)ethenyl]amino]ethanol is Cc1ccc(C=CN(CCO)CCO)cc1.OB(O)O.
What is the InChIKey of boric acid;2-[2-hydroxyethyl-[2-(4-methylphenyl)ethenyl]amino]ethanol?
The InChIKey is KMZXZDVKQUCANJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO2.BH3O3/c1-12-2-4-13(5-3-12)6-7-14(8-10-15)9-11-16;2-1(3)4/h2-7,15-16H,8-11H2,1H3;2-4H.
What are the key properties of boric acid;2-[2-hydroxyethyl-[2-(4-methylphenyl)ethenyl]amino]ethanol?
boric acid;2-[2-hydroxyethyl-[2-(4-methylphenyl)ethenyl]amino]ethanol has a molecular weight of 283.13 g/mol, XLogP of -0.80, 6 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for boric acid;2-[2-hydroxyethyl-[2-(4-methylphenyl)ethenyl]amino]ethanol is sourced from PubChem (CID 175194087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).