About [(1R,3S)-3-fluoro-4-oxocyclohexyl] carbamate
[(1R,3S)-3-fluoro-4-oxocyclohexyl] carbamate (PubChem CID 175194220) has the molecular formula C7H10FNO3
and a molecular weight of 175.16 g/mol. Its IUPAC name is [(1R,3S)-3-fluoro-4-oxocyclohexyl] carbamate.
Molecular Properties
| Compound Name | [(1R,3S)-3-fluoro-4-oxocyclohexyl] carbamate |
| PubChem CID | 175194220 |
| Molecular Formula | C7H10FNO3 |
| Molecular Weight | 175.16 g/mol |
| Exact Mass | 175.06 |
| IUPAC Name | [(1R,3S)-3-fluoro-4-oxocyclohexyl] carbamate |
| SMILES | NC(=O)O[C@@H]1CCC(=O)[C@@H](F)C1 |
| InChI | InChI=1S/C7H10FNO3/c8-5-3-4(12-7(9)11)1-2-6(5)10/h4-5H,1-3H2,(H2,9,11)/t4-,5+/m1/s1 |
| InChIKey | ODYOGYOWAMKVIQ-UHNVWZDZSA-N |
| XLogP | 0.54 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.16 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(1R,3S)-3-fluoro-4-oxocyclohexyl] carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,3S)-3-fluoro-4-oxocyclohexyl] carbamate?
The IUPAC name of [(1R,3S)-3-fluoro-4-oxocyclohexyl] carbamate (CID 175194220) is [(1R,3S)-3-fluoro-4-oxocyclohexyl] carbamate.
What is the SMILES notation for [(1R,3S)-3-fluoro-4-oxocyclohexyl] carbamate?
The canonical SMILES for [(1R,3S)-3-fluoro-4-oxocyclohexyl] carbamate is NC(=O)O[C@@H]1CCC(=O)[C@@H](F)C1.
What is the InChIKey of [(1R,3S)-3-fluoro-4-oxocyclohexyl] carbamate?
The InChIKey is ODYOGYOWAMKVIQ-UHNVWZDZSA-N. The full InChI is InChI=1S/C7H10FNO3/c8-5-3-4(12-7(9)11)1-2-6(5)10/h4-5H,1-3H2,(H2,9,11)/t4-,5+/m1/s1.
What are the key properties of [(1R,3S)-3-fluoro-4-oxocyclohexyl] carbamate?
[(1R,3S)-3-fluoro-4-oxocyclohexyl] carbamate has a molecular weight of 175.16 g/mol, XLogP of 0.54, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,3S)-3-fluoro-4-oxocyclohexyl] carbamate is sourced from PubChem (CID 175194220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).