C33H49NO3 — CID 175194317
(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-(6-methyl-7-nitro-7-phenylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 175194317) has the molecular formula C33H49NO3 and a molecular weight of 507.76 g/mol. Its IUPAC name is (3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-(6-methyl-7-nitro-7-phenylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-(6-methyl-7-nitro-7-phenylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 175194317 |
| Molecular Formula | C33H49NO3 |
| Molecular Weight | 507.76 g/mol |
| Exact Mass | 507.37 |
| IUPAC Name | (3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-(6-methyl-7-nitro-7-phenylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | CC(CCCC(C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C)C(c1ccccc1)[N+](=O)[O-] |
| InChI | InChI=1S/C33H49NO3/c1-22(9-8-10-23(2)31(34(36)37)24-11-6-5-7-12-24)28-15-16-29-27-14-13-25-21-26(35)17-19-32(25,3)30(27)18-20-33(28,29)4/h5-7,11-13,22-23,26-31,35H,8-10,14-21H2,1-4H3/t22?,23?,26-,27-,28+,29-,30-,31?,32-,33+/m0/s1 |
| InChIKey | XTYMNCNIMFZZTJ-FKWJNWEUSA-N |
| XLogP | 8.39 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.76 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|