C30H32N2O4 — CID 175194789
N-(1-benzylpiperidin-4-yl)-2-[4-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]phenoxy]acetamide (PubChem CID 175194789) has the molecular formula C30H32N2O4 and a molecular weight of 484.60 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-2-[4-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]phenoxy]acetamide.
| Compound Name | N-(1-benzylpiperidin-4-yl)-2-[4-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 175194789 |
| Molecular Formula | C30H32N2O4 |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.24 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-2-[4-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]phenoxy]acetamide |
| SMILES | COc1ccc(/C=C/C(=O)c2ccc(OCC(=O)NC3CCN(Cc4ccccc4)CC3)cc2)cc1 |
| InChI | InChI=1S/C30H32N2O4/c1-35-27-12-7-23(8-13-27)9-16-29(33)25-10-14-28(15-11-25)36-22-30(34)31-26-17-19-32(20-18-26)21-24-5-3-2-4-6-24/h2-16,26H,17-22H2,1H3,(H,31,34)/b16-9+ |
| InChIKey | CEVYEQNAFWETAK-CXUHLZMHSA-N |
| XLogP | 4.75 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|