C26H30O17 — CID 175195831
bis(bicyclo[2.2.1]heptane-1,2,2,3-tetracarboxylic acid);cyclobutanone (PubChem CID 175195831) has the molecular formula C26H30O17 and a molecular weight of 614.51 g/mol. Its IUPAC name is bis(bicyclo[2.2.1]heptane-1,2,2,3-tetracarboxylic acid);cyclobutanone.
| Compound Name | bis(bicyclo[2.2.1]heptane-1,2,2,3-tetracarboxylic acid);cyclobutanone |
|---|---|
| PubChem CID | 175195831 |
| Molecular Formula | C26H30O17 |
| Molecular Weight | 614.51 g/mol |
| Exact Mass | 614.15 |
| IUPAC Name | bis(bicyclo[2.2.1]heptane-1,2,2,3-tetracarboxylic acid);cyclobutanone |
| SMILES | O=C(O)C1C2CCC(C(=O)O)(C2)C1(C(=O)O)C(=O)O.O=C(O)C1C2CCC(C(=O)O)(C2)C1(C(=O)O)C(=O)O.O=C1CCC1 |
| InChI | InChI=1S/2C11H12O8.C4H6O/c2*12-6(13)5-4-1-2-10(3-4,7(14)15)11(5,8(16)17)9(18)19;5-4-2-1-3-4/h2*4-5H,1-3H2,(H,12,13)(H,14,15)(H,16,17)(H,18,19);1-3H2 |
| InChIKey | YJASTVKVNWEBJM-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 315.47 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.51 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|