C4H8N6OS2 — CID 175196538
carbonodithioic S,S-acid;1,3,5-triazine-2,4,6-triamine (PubChem CID 175196538) has the molecular formula C4H8N6OS2 and a molecular weight of 220.28 g/mol. Its IUPAC name is carbonodithioic S,S-acid;1,3,5-triazine-2,4,6-triamine.
| Compound Name | carbonodithioic S,S-acid;1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 175196538 |
| Molecular Formula | C4H8N6OS2 |
| Molecular Weight | 220.28 g/mol |
| Exact Mass | 220.02 |
| IUPAC Name | carbonodithioic S,S-acid;1,3,5-triazine-2,4,6-triamine |
| SMILES | Nc1nc(N)nc(N)n1.O=C(S)S |
| InChI | InChI=1S/C3H6N6.CH2OS2/c4-1-7-2(5)9-3(6)8-1;2-1(3)4/h(H6,4,5,6,7,8,9);(H2,2,3,4) |
| InChIKey | CXAFBDLEQOXJHZ-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 133.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.28 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|