C15H12BrClN6O4 — CID 175196750
3-bromo-1-(3-chloro-2-pyridinyl)-N-[1-(3-hydrazinyl-2,3-dioxopropanoyl)cyclopropyl]pyrazole-5-carboxamide (PubChem CID 175196750) has the molecular formula C15H12BrClN6O4 and a molecular weight of 455.66 g/mol. Its IUPAC name is 3-bromo-1-(3-chloro-2-pyridinyl)-N-[1-(3-hydrazinyl-2,3-dioxopropanoyl)cyclopropyl]pyrazole-5-carboxamide.
| Compound Name | 3-bromo-1-(3-chloro-2-pyridinyl)-N-[1-(3-hydrazinyl-2,3-dioxopropanoyl)cyclopropyl]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 175196750 |
| Molecular Formula | C15H12BrClN6O4 |
| Molecular Weight | 455.66 g/mol |
| Exact Mass | 453.98 |
| IUPAC Name | 3-bromo-1-(3-chloro-2-pyridinyl)-N-[1-(3-hydrazinyl-2,3-dioxopropanoyl)cyclopropyl]pyrazole-5-carboxamide |
| SMILES | NNC(=O)C(=O)C(=O)C1(NC(=O)c2cc(Br)nn2-c2ncccc2Cl)CC1 |
| InChI | InChI=1S/C15H12BrClN6O4/c16-9-6-8(23(22-9)12-7(17)2-1-5-19-12)13(26)20-15(3-4-15)11(25)10(24)14(27)21-18/h1-2,5-6H,3-4,18H2,(H,20,26)(H,21,27) |
| InChIKey | HJRCAXJZANTOHW-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 149.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.66 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|