C4H4N10O4 — CID 175197119
N-[3-(3-amino-1H-1,2,4-triazol-5-yl)-1H-1,2,4-triazol-5-yl]-N-nitronitramide (PubChem CID 175197119) has the molecular formula C4H4N10O4 and a molecular weight of 256.14 g/mol. Its IUPAC name is N-[3-(3-amino-1H-1,2,4-triazol-5-yl)-1H-1,2,4-triazol-5-yl]-N-nitronitramide.
| Compound Name | N-[3-(3-amino-1H-1,2,4-triazol-5-yl)-1H-1,2,4-triazol-5-yl]-N-nitronitramide |
|---|---|
| PubChem CID | 175197119 |
| Molecular Formula | C4H4N10O4 |
| Molecular Weight | 256.14 g/mol |
| Exact Mass | 256.04 |
| IUPAC Name | N-[3-(3-amino-1H-1,2,4-triazol-5-yl)-1H-1,2,4-triazol-5-yl]-N-nitronitramide |
| SMILES | Nc1n[nH]c(-c2n[nH]c(N([N+](=O)[O-])[N+](=O)[O-])n2)n1 |
| InChI | InChI=1S/C4H4N10O4/c5-3-6-1(8-10-3)2-7-4(11-9-2)12(13(15)16)14(17)18/h(H,7,9,11)(H3,5,6,8,10) |
| InChIKey | OBIDSXCLXOVYRD-UHFFFAOYSA-N |
| XLogP | -1.64 |
| TPSA | 198.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.14 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|