C11H8IP — CID 175197676
2-iodo-2-phosphatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene (PubChem CID 175197676) has the molecular formula C11H8IP and a molecular weight of 298.06 g/mol. Its IUPAC name is 2-iodo-2-phosphatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene.
| Compound Name | 2-iodo-2-phosphatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene |
|---|---|
| PubChem CID | 175197676 |
| Molecular Formula | C11H8IP |
| Molecular Weight | 298.06 g/mol |
| Exact Mass | 297.94 |
| IUPAC Name | 2-iodo-2-phosphatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene |
| SMILES | IP1Cc2cccc3cccc1c23 |
| InChI | InChI=1S/C11H8IP/c12-13-7-9-5-1-3-8-4-2-6-10(13)11(8)9/h1-6H,7H2 |
| InChIKey | XZUSSFSITQNHRN-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.06 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|