About N-phenylmorpholin-4-amine;pyrene-1-carbaldehyde
N-phenylmorpholin-4-amine;pyrene-1-carbaldehyde (PubChem CID 175197775) has the molecular formula C27H24N2O2
and a molecular weight of 408.50 g/mol. Its IUPAC name is N-phenylmorpholin-4-amine;pyrene-1-carbaldehyde.
Molecular Properties
| Compound Name | N-phenylmorpholin-4-amine;pyrene-1-carbaldehyde |
| PubChem CID | 175197775 |
| Molecular Formula | C27H24N2O2 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | N-phenylmorpholin-4-amine;pyrene-1-carbaldehyde |
| SMILES | O=Cc1ccc2ccc3cccc4ccc1c2c34.c1ccc(NN2CCOCC2)cc1 |
| InChI | InChI=1S/C17H10O.C10H14N2O/c18-10-14-7-6-13-5-4-11-2-1-3-12-8-9-15(14)17(13)16(11)12;1-2-4-10(5-3-1)11-12-6-8-13-9-7-12/h1-10H;1-5,11H,6-9H2 |
| InChIKey | ZKRQEQAKBBRYLE-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze N-phenylmorpholin-4-amine;pyrene-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-phenylmorpholin-4-amine;pyrene-1-carbaldehyde?
The IUPAC name of N-phenylmorpholin-4-amine;pyrene-1-carbaldehyde (CID 175197775) is N-phenylmorpholin-4-amine;pyrene-1-carbaldehyde.
What is the SMILES notation for N-phenylmorpholin-4-amine;pyrene-1-carbaldehyde?
The canonical SMILES for N-phenylmorpholin-4-amine;pyrene-1-carbaldehyde is O=Cc1ccc2ccc3cccc4ccc1c2c34.c1ccc(NN2CCOCC2)cc1.
What is the InChIKey of N-phenylmorpholin-4-amine;pyrene-1-carbaldehyde?
The InChIKey is ZKRQEQAKBBRYLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H10O.C10H14N2O/c18-10-14-7-6-13-5-4-11-2-1-3-12-8-9-15(14)17(13)16(11)12;1-2-4-10(5-3-1)11-12-6-8-13-9-7-12/h1-10H;1-5,11H,6-9H2.
What are the key properties of N-phenylmorpholin-4-amine;pyrene-1-carbaldehyde?
N-phenylmorpholin-4-amine;pyrene-1-carbaldehyde has a molecular weight of 408.50 g/mol, XLogP of 5.74, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-phenylmorpholin-4-amine;pyrene-1-carbaldehyde is sourced from PubChem (CID 175197775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).