C25H20ClF2N7O5 — CID 175197877
N-[3-[5-chloro-2-(difluoromethoxy)phenyl]-1-[2-[(2,3,5-trioxocyclopentyl)methylamino]ethyl]pyrazol-4-yl]pyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 175197877) has the molecular formula C25H20ClF2N7O5 and a molecular weight of 571.93 g/mol. Its IUPAC name is N-[3-[5-chloro-2-(difluoromethoxy)phenyl]-1-[2-[(2,3,5-trioxocyclopentyl)methylamino]ethyl]pyrazol-4-yl]pyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | N-[3-[5-chloro-2-(difluoromethoxy)phenyl]-1-[2-[(2,3,5-trioxocyclopentyl)methylamino]ethyl]pyrazol-4-yl]pyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 175197877 |
| Molecular Formula | C25H20ClF2N7O5 |
| Molecular Weight | 571.93 g/mol |
| Exact Mass | 571.12 |
| IUPAC Name | N-[3-[5-chloro-2-(difluoromethoxy)phenyl]-1-[2-[(2,3,5-trioxocyclopentyl)methylamino]ethyl]pyrazol-4-yl]pyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | O=C1CC(=O)C(CNCCn2cc(NC(=O)c3cnn4cccnc34)c(-c3cc(Cl)ccc3OC(F)F)n2)C1=O |
| InChI | InChI=1S/C25H20ClF2N7O5/c26-13-2-3-20(40-25(27)28)14(8-13)21-17(32-24(39)16-11-31-35-6-1-4-30-23(16)35)12-34(33-21)7-5-29-10-15-18(36)9-19(37)22(15)38/h1-4,6,8,11-12,15,25,29H,5,7,9-10H2,(H,32,39) |
| InChIKey | XAGFPNZBEQHHKB-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 149.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.93 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|