C8H8Br2Cl4N2 — CID 175198471
2,3-dibromo-2-methylpropanenitrile;2,3,3-trichloro-2-(chloromethyl)propanenitrile (PubChem CID 175198471) has the molecular formula C8H8Br2Cl4N2 and a molecular weight of 433.79 g/mol. Its IUPAC name is 2,3-dibromo-2-methylpropanenitrile;2,3,3-trichloro-2-(chloromethyl)propanenitrile.
| Compound Name | 2,3-dibromo-2-methylpropanenitrile;2,3,3-trichloro-2-(chloromethyl)propanenitrile |
|---|---|
| PubChem CID | 175198471 |
| Molecular Formula | C8H8Br2Cl4N2 |
| Molecular Weight | 433.79 g/mol |
| Exact Mass | 429.78 |
| IUPAC Name | 2,3-dibromo-2-methylpropanenitrile;2,3,3-trichloro-2-(chloromethyl)propanenitrile |
| SMILES | CC(Br)(C#N)CBr.N#CC(Cl)(CCl)C(Cl)Cl |
| InChI | InChI=1S/C4H5Br2N.C4H3Cl4N/c1-4(6,2-5)3-7;5-1-4(8,2-9)3(6)7/h2H2,1H3;3H,1H2 |
| InChIKey | IAGZBTQKQQSWQX-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.79 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|