C14H25F3N2O3 — CID 175198477
N-(1-piperidin-4-ylpropyl)butanamide;2,2,2-trifluoroacetic acid (PubChem CID 175198477) has the molecular formula C14H25F3N2O3 and a molecular weight of 326.36 g/mol. Its IUPAC name is N-(1-piperidin-4-ylpropyl)butanamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-(1-piperidin-4-ylpropyl)butanamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 175198477 |
| Molecular Formula | C14H25F3N2O3 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.18 |
| IUPAC Name | N-(1-piperidin-4-ylpropyl)butanamide;2,2,2-trifluoroacetic acid |
| SMILES | CCCC(=O)NC(CC)C1CCNCC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C12H24N2O.C2HF3O2/c1-3-5-12(15)14-11(4-2)10-6-8-13-9-7-10;3-2(4,5)1(6)7/h10-11,13H,3-9H2,1-2H3,(H,14,15);(H,6,7) |
| InChIKey | COBAGRDPXHIHFO-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |