About methylaminomethanethiol;2-(2-pentylhydrazinyl)-N-pyren-1-ylacetamide
methylaminomethanethiol;2-(2-pentylhydrazinyl)-N-pyren-1-ylacetamide (PubChem CID 175198526) has the molecular formula C25H32N4OS
and a molecular weight of 436.63 g/mol. Its IUPAC name is methylaminomethanethiol;2-(2-pentylhydrazinyl)-N-pyren-1-ylacetamide.
Molecular Properties
| Compound Name | methylaminomethanethiol;2-(2-pentylhydrazinyl)-N-pyren-1-ylacetamide |
| PubChem CID | 175198526 |
| Molecular Formula | C25H32N4OS |
| Molecular Weight | 436.63 g/mol |
| Exact Mass | 436.23 |
| IUPAC Name | methylaminomethanethiol;2-(2-pentylhydrazinyl)-N-pyren-1-ylacetamide |
| SMILES | CCCCCNNCC(=O)Nc1ccc2ccc3cccc4ccc1c2c34.CNCS |
| InChI | InChI=1S/C23H25N3O.C2H7NS/c1-2-3-4-14-24-25-15-21(27)26-20-13-11-18-9-8-16-6-5-7-17-10-12-19(20)23(18)22(16)17;1-3-2-4/h5-13,24-25H,2-4,14-15H2,1H3,(H,26,27);3-4H,2H2,1H3 |
| InChIKey | ZQDPZVCMYCPQLN-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 65.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 436.63 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze methylaminomethanethiol;2-(2-pentylhydrazinyl)-N-pyren-1-ylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylaminomethanethiol;2-(2-pentylhydrazinyl)-N-pyren-1-ylacetamide?
The IUPAC name of methylaminomethanethiol;2-(2-pentylhydrazinyl)-N-pyren-1-ylacetamide (CID 175198526) is methylaminomethanethiol;2-(2-pentylhydrazinyl)-N-pyren-1-ylacetamide.
What is the SMILES notation for methylaminomethanethiol;2-(2-pentylhydrazinyl)-N-pyren-1-ylacetamide?
The canonical SMILES for methylaminomethanethiol;2-(2-pentylhydrazinyl)-N-pyren-1-ylacetamide is CCCCCNNCC(=O)Nc1ccc2ccc3cccc4ccc1c2c34.CNCS.
What is the InChIKey of methylaminomethanethiol;2-(2-pentylhydrazinyl)-N-pyren-1-ylacetamide?
The InChIKey is ZQDPZVCMYCPQLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H25N3O.C2H7NS/c1-2-3-4-14-24-25-15-21(27)26-20-13-11-18-9-8-16-6-5-7-17-10-12-19(20)23(18)22(16)17;1-3-2-4/h5-13,24-25H,2-4,14-15H2,1H3,(H,26,27);3-4H,2H2,1H3.
What are the key properties of methylaminomethanethiol;2-(2-pentylhydrazinyl)-N-pyren-1-ylacetamide?
methylaminomethanethiol;2-(2-pentylhydrazinyl)-N-pyren-1-ylacetamide has a molecular weight of 436.63 g/mol, XLogP of 4.90, 9 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methylaminomethanethiol;2-(2-pentylhydrazinyl)-N-pyren-1-ylacetamide is sourced from PubChem (CID 175198526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).