C9H3BrF5N — CID 175198869
2-bromo-3-(2,3-difluorophenyl)-2,3,3-trifluoropropanenitrile (PubChem CID 175198869) has the molecular formula C9H3BrF5N and a molecular weight of 300.02 g/mol. Its IUPAC name is 2-bromo-3-(2,3-difluorophenyl)-2,3,3-trifluoropropanenitrile.
| Compound Name | 2-bromo-3-(2,3-difluorophenyl)-2,3,3-trifluoropropanenitrile |
|---|---|
| PubChem CID | 175198869 |
| Molecular Formula | C9H3BrF5N |
| Molecular Weight | 300.02 g/mol |
| Exact Mass | 298.94 |
| IUPAC Name | 2-bromo-3-(2,3-difluorophenyl)-2,3,3-trifluoropropanenitrile |
| SMILES | N#CC(F)(Br)C(F)(F)c1cccc(F)c1F |
| InChI | InChI=1S/C9H3BrF5N/c10-8(13,4-16)9(14,15)5-2-1-3-6(11)7(5)12/h1-3H |
| InChIKey | VQKDRGQXCFECEJ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.02 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|