C9H17IN2O4 — CID 175199405
(2S)-3-iodo-2-(methylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (PubChem CID 175199405) has the molecular formula C9H17IN2O4 and a molecular weight of 344.15 g/mol. Its IUPAC name is (2S)-3-iodo-2-(methylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid.
| Compound Name | (2S)-3-iodo-2-(methylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
|---|---|
| PubChem CID | 175199405 |
| Molecular Formula | C9H17IN2O4 |
| Molecular Weight | 344.15 g/mol |
| Exact Mass | 344.02 |
| IUPAC Name | (2S)-3-iodo-2-(methylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| SMILES | CN[C@](CI)(NC(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C9H17IN2O4/c1-8(2,3)16-7(15)12-9(5-10,11-4)6(13)14/h11H,5H2,1-4H3,(H,12,15)(H,13,14)/t9-/m1/s1 |
| InChIKey | RIUIGMSOHWQFQC-SECBINFHSA-N |
| XLogP | 0.95 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.15 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|