C9H13Cl2F — CID 175199470
5,6-dichloro-3-fluoro-1,3,5-trimethylcyclohexene (PubChem CID 175199470) has the molecular formula C9H13Cl2F and a molecular weight of 211.11 g/mol. Its IUPAC name is 5,6-dichloro-3-fluoro-1,3,5-trimethylcyclohexene.
| Compound Name | 5,6-dichloro-3-fluoro-1,3,5-trimethylcyclohexene |
|---|---|
| PubChem CID | 175199470 |
| Molecular Formula | C9H13Cl2F |
| Molecular Weight | 211.11 g/mol |
| Exact Mass | 210.04 |
| IUPAC Name | 5,6-dichloro-3-fluoro-1,3,5-trimethylcyclohexene |
| SMILES | CC1=CC(C)(F)CC(C)(Cl)C1Cl |
| InChI | InChI=1S/C9H13Cl2F/c1-6-4-8(2,12)5-9(3,11)7(6)10/h4,7H,5H2,1-3H3 |
| InChIKey | VTNCHHJFWVXVIB-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.11 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|