C13H19ClN2O5S — CID 175199530
2-[4-[[6-chloro-4-(methylsulfonylmethyl)-2-pyridinyl]amino]butoxy]acetic acid (PubChem CID 175199530) has the molecular formula C13H19ClN2O5S and a molecular weight of 350.82 g/mol. Its IUPAC name is 2-[4-[[6-chloro-4-(methylsulfonylmethyl)-2-pyridinyl]amino]butoxy]acetic acid.
| Compound Name | 2-[4-[[6-chloro-4-(methylsulfonylmethyl)-2-pyridinyl]amino]butoxy]acetic acid |
|---|---|
| PubChem CID | 175199530 |
| Molecular Formula | C13H19ClN2O5S |
| Molecular Weight | 350.82 g/mol |
| Exact Mass | 350.07 |
| IUPAC Name | 2-[4-[[6-chloro-4-(methylsulfonylmethyl)-2-pyridinyl]amino]butoxy]acetic acid |
| SMILES | CS(=O)(=O)Cc1cc(Cl)nc(NCCCCOCC(=O)O)c1 |
| InChI | InChI=1S/C13H19ClN2O5S/c1-22(19,20)9-10-6-11(14)16-12(7-10)15-4-2-3-5-21-8-13(17)18/h6-7H,2-5,8-9H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | NGWZOSOCXVDLNX-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 105.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.82 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|