C16H19IN2O3 — CID 175199579
[3-(4-cyano-3-iodophenoxy)-2,2,4,4-tetramethylcyclobutyl] carbamate (PubChem CID 175199579) has the molecular formula C16H19IN2O3 and a molecular weight of 414.24 g/mol. Its IUPAC name is [3-(4-cyano-3-iodophenoxy)-2,2,4,4-tetramethylcyclobutyl] carbamate.
| Compound Name | [3-(4-cyano-3-iodophenoxy)-2,2,4,4-tetramethylcyclobutyl] carbamate |
|---|---|
| PubChem CID | 175199579 |
| Molecular Formula | C16H19IN2O3 |
| Molecular Weight | 414.24 g/mol |
| Exact Mass | 414.04 |
| IUPAC Name | [3-(4-cyano-3-iodophenoxy)-2,2,4,4-tetramethylcyclobutyl] carbamate |
| SMILES | CC1(C)C(OC(N)=O)C(C)(C)C1Oc1ccc(C#N)c(I)c1 |
| InChI | InChI=1S/C16H19IN2O3/c1-15(2)12(16(3,4)13(15)22-14(19)20)21-10-6-5-9(8-18)11(17)7-10/h5-7,12-13H,1-4H3,(H2,19,20) |
| InChIKey | DZBSOAXGCQFKNH-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 85.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.24 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|