About (4-oxocyclohexen-1-yl) acetate
(4-oxocyclohexen-1-yl) acetate (PubChem CID 175199899) has the molecular formula C8H10O3
and a molecular weight of 154.16 g/mol. Its IUPAC name is (4-oxocyclohexen-1-yl) acetate.
Molecular Properties
| Compound Name | (4-oxocyclohexen-1-yl) acetate |
| PubChem CID | 175199899 |
| Molecular Formula | C8H10O3 |
| Molecular Weight | 154.16 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | (4-oxocyclohexen-1-yl) acetate |
| SMILES | CC(=O)OC1=CCC(=O)CC1 |
| InChI | InChI=1S/C8H10O3/c1-6(9)11-8-4-2-7(10)3-5-8/h4H,2-3,5H2,1H3 |
| InChIKey | JACPHKGPVYLZBV-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.16 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4-oxocyclohexen-1-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-oxocyclohexen-1-yl) acetate?
The IUPAC name of (4-oxocyclohexen-1-yl) acetate (CID 175199899) is (4-oxocyclohexen-1-yl) acetate.
What is the SMILES notation for (4-oxocyclohexen-1-yl) acetate?
The canonical SMILES for (4-oxocyclohexen-1-yl) acetate is CC(=O)OC1=CCC(=O)CC1.
What is the InChIKey of (4-oxocyclohexen-1-yl) acetate?
The InChIKey is JACPHKGPVYLZBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O3/c1-6(9)11-8-4-2-7(10)3-5-8/h4H,2-3,5H2,1H3.
What are the key properties of (4-oxocyclohexen-1-yl) acetate?
(4-oxocyclohexen-1-yl) acetate has a molecular weight of 154.16 g/mol, XLogP of 1.19, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-oxocyclohexen-1-yl) acetate is sourced from PubChem (CID 175199899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).