C23H28FN3O5 — CID 175200420
ethyl 3-[2-[[(2S)-3-(4-aminophenyl)-2-(ethoxycarbonylamino)propanoyl]amino]-6-fluorophenyl]propanoate (PubChem CID 175200420) has the molecular formula C23H28FN3O5 and a molecular weight of 445.49 g/mol. Its IUPAC name is ethyl 3-[2-[[(2S)-3-(4-aminophenyl)-2-(ethoxycarbonylamino)propanoyl]amino]-6-fluorophenyl]propanoate.
| Compound Name | ethyl 3-[2-[[(2S)-3-(4-aminophenyl)-2-(ethoxycarbonylamino)propanoyl]amino]-6-fluorophenyl]propanoate |
|---|---|
| PubChem CID | 175200420 |
| Molecular Formula | C23H28FN3O5 |
| Molecular Weight | 445.49 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | ethyl 3-[2-[[(2S)-3-(4-aminophenyl)-2-(ethoxycarbonylamino)propanoyl]amino]-6-fluorophenyl]propanoate |
| SMILES | CCOC(=O)CCc1c(F)cccc1NC(=O)[C@H](Cc1ccc(N)cc1)NC(=O)OCC |
| InChI | InChI=1S/C23H28FN3O5/c1-3-31-21(28)13-12-17-18(24)6-5-7-19(17)26-22(29)20(27-23(30)32-4-2)14-15-8-10-16(25)11-9-15/h5-11,20H,3-4,12-14,25H2,1-2H3,(H,26,29)(H,27,30)/t20-/m0/s1 |
| InChIKey | HBWZVKPOALBXQQ-FQEVSTJZSA-N |
| XLogP | 3.20 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.49 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|