C26H23F7N2O4S — CID 175200742
N-[4-(2-fluorophenyl)-1-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexa-2,4-dien-1-yl]-6-methylsulfonyl-1,2,3,4-tetrahydroisoquinoline-1-carboxamide (PubChem CID 175200742) has the molecular formula C26H23F7N2O4S and a molecular weight of 592.53 g/mol. Its IUPAC name is N-[4-(2-fluorophenyl)-1-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexa-2,4-dien-1-yl]-6-methylsulfonyl-1,2,3,4-tetrahydroisoquinoline-1-carboxamide.
| Compound Name | N-[4-(2-fluorophenyl)-1-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexa-2,4-dien-1-yl]-6-methylsulfonyl-1,2,3,4-tetrahydroisoquinoline-1-carboxamide |
|---|---|
| PubChem CID | 175200742 |
| Molecular Formula | C26H23F7N2O4S |
| Molecular Weight | 592.53 g/mol |
| Exact Mass | 592.13 |
| IUPAC Name | N-[4-(2-fluorophenyl)-1-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexa-2,4-dien-1-yl]-6-methylsulfonyl-1,2,3,4-tetrahydroisoquinoline-1-carboxamide |
| SMILES | CS(=O)(=O)c1ccc2c(c1)CCNC2C(=O)NC1(C(O)(C(F)(F)F)C(F)(F)F)C=CC(c2ccccc2F)=CC1 |
| InChI | InChI=1S/C26H23F7N2O4S/c1-40(38,39)17-6-7-19-16(14-17)10-13-34-21(19)22(36)35-23(24(37,25(28,29)30)26(31,32)33)11-8-15(9-12-23)18-4-2-3-5-20(18)27/h2-9,11,14,21,34,37H,10,12-13H2,1H3,(H,35,36) |
| InChIKey | XMQGAJFZIRJNQC-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.53 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |