About (1-methylpyrazol-4-yl) oxolane-2-carboxylate
(1-methylpyrazol-4-yl) oxolane-2-carboxylate (PubChem CID 175201129) has the molecular formula C9H12N2O3
and a molecular weight of 196.21 g/mol. Its IUPAC name is (1-methylpyrazol-4-yl) oxolane-2-carboxylate.
Molecular Properties
| Compound Name | (1-methylpyrazol-4-yl) oxolane-2-carboxylate |
| PubChem CID | 175201129 |
| Molecular Formula | C9H12N2O3 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | (1-methylpyrazol-4-yl) oxolane-2-carboxylate |
| SMILES | Cn1cc(OC(=O)C2CCCO2)cn1 |
| InChI | InChI=1S/C9H12N2O3/c1-11-6-7(5-10-11)14-9(12)8-3-2-4-13-8/h5-6,8H,2-4H2,1H3 |
| InChIKey | GMLKRGBMWPQALR-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (1-methylpyrazol-4-yl) oxolane-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methylpyrazol-4-yl) oxolane-2-carboxylate?
The IUPAC name of (1-methylpyrazol-4-yl) oxolane-2-carboxylate (CID 175201129) is (1-methylpyrazol-4-yl) oxolane-2-carboxylate.
What is the SMILES notation for (1-methylpyrazol-4-yl) oxolane-2-carboxylate?
The canonical SMILES for (1-methylpyrazol-4-yl) oxolane-2-carboxylate is Cn1cc(OC(=O)C2CCCO2)cn1.
What is the InChIKey of (1-methylpyrazol-4-yl) oxolane-2-carboxylate?
The InChIKey is GMLKRGBMWPQALR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O3/c1-11-6-7(5-10-11)14-9(12)8-3-2-4-13-8/h5-6,8H,2-4H2,1H3.
What are the key properties of (1-methylpyrazol-4-yl) oxolane-2-carboxylate?
(1-methylpyrazol-4-yl) oxolane-2-carboxylate has a molecular weight of 196.21 g/mol, XLogP of 0.50, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methylpyrazol-4-yl) oxolane-2-carboxylate is sourced from PubChem (CID 175201129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).