About acetic acid;chrysene
acetic acid;chrysene (PubChem CID 175201446) has the molecular formula C20H16O2
and a molecular weight of 288.35 g/mol. Its IUPAC name is acetic acid;chrysene.
Molecular Properties
| Compound Name | acetic acid;chrysene |
| PubChem CID | 175201446 |
| Molecular Formula | C20H16O2 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | acetic acid;chrysene |
| SMILES | CC(=O)O.c1ccc2c(c1)ccc1c3ccccc3ccc21 |
| InChI | InChI=1S/C18H12.C2H4O2/c1-3-7-15-13(5-1)9-11-18-16-8-4-2-6-14(16)10-12-17(15)18;1-2(3)4/h1-12H;1H3,(H,3,4) |
| InChIKey | XQIOZCAJPWBLLY-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;chrysene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;chrysene?
The IUPAC name of acetic acid;chrysene (CID 175201446) is acetic acid;chrysene.
What is the SMILES notation for acetic acid;chrysene?
The canonical SMILES for acetic acid;chrysene is CC(=O)O.c1ccc2c(c1)ccc1c3ccccc3ccc21.
What is the InChIKey of acetic acid;chrysene?
The InChIKey is XQIOZCAJPWBLLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12.C2H4O2/c1-3-7-15-13(5-1)9-11-18-16-8-4-2-6-14(16)10-12-17(15)18;1-2(3)4/h1-12H;1H3,(H,3,4).
What are the key properties of acetic acid;chrysene?
acetic acid;chrysene has a molecular weight of 288.35 g/mol, XLogP of 5.24, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;chrysene is sourced from PubChem (CID 175201446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).