C15H24O4 — CID 175202748
(3aS,4R,6aS,10aR)-3a-hydroxy-4-(hydroxymethyl)-7,7-dimethyl-3,4,5,6,6a,8,9,10-octahydrobenzo[h][2]benzofuran-1-one (PubChem CID 175202748) has the molecular formula C15H24O4 and a molecular weight of 268.35 g/mol. Its IUPAC name is (3aS,4R,6aS,10aR)-3a-hydroxy-4-(hydroxymethyl)-7,7-dimethyl-3,4,5,6,6a,8,9,10-octahydrobenzo[h][2]benzofuran-1-one.
| Compound Name | (3aS,4R,6aS,10aR)-3a-hydroxy-4-(hydroxymethyl)-7,7-dimethyl-3,4,5,6,6a,8,9,10-octahydrobenzo[h][2]benzofuran-1-one |
|---|---|
| PubChem CID | 175202748 |
| Molecular Formula | C15H24O4 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | (3aS,4R,6aS,10aR)-3a-hydroxy-4-(hydroxymethyl)-7,7-dimethyl-3,4,5,6,6a,8,9,10-octahydrobenzo[h][2]benzofuran-1-one |
| SMILES | CC1(C)CCC[C@]23C(=O)OC[C@]2(O)[C@@H](CO)CC[C@@H]13 |
| InChI | InChI=1S/C15H24O4/c1-13(2)6-3-7-14-11(13)5-4-10(8-16)15(14,18)9-19-12(14)17/h10-11,16,18H,3-9H2,1-2H3/t10-,11+,14+,15+/m1/s1 |
| InChIKey | WLORBGDSFAQVCF-PKIAMQTDSA-N |
| XLogP | 1.49 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |