C6H6F7N — CID 175203003
1,1,2,2,3,3,3-heptafluoro-N-prop-1-enylpropan-1-amine (PubChem CID 175203003) has the molecular formula C6H6F7N and a molecular weight of 225.11 g/mol. Its IUPAC name is 1,1,2,2,3,3,3-heptafluoro-N-prop-1-enylpropan-1-amine.
| Compound Name | 1,1,2,2,3,3,3-heptafluoro-N-prop-1-enylpropan-1-amine |
|---|---|
| PubChem CID | 175203003 |
| Molecular Formula | C6H6F7N |
| Molecular Weight | 225.11 g/mol |
| Exact Mass | 225.04 |
| IUPAC Name | 1,1,2,2,3,3,3-heptafluoro-N-prop-1-enylpropan-1-amine |
| SMILES | CC=CNC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H6F7N/c1-2-3-14-6(12,13)4(7,8)5(9,10)11/h2-3,14H,1H3 |
| InChIKey | BUBKPOHXLNQKAR-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.11 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|