C11H17F9OSi — CID 175203408
(4,5,5,6,6,7,8,9,9-nonafluoro-2,3-dimethylnonan-2-yl)oxysilane (PubChem CID 175203408) has the molecular formula C11H17F9OSi and a molecular weight of 364.32 g/mol. Its IUPAC name is (4,5,5,6,6,7,8,9,9-nonafluoro-2,3-dimethylnonan-2-yl)oxysilane.
| Compound Name | (4,5,5,6,6,7,8,9,9-nonafluoro-2,3-dimethylnonan-2-yl)oxysilane |
|---|---|
| PubChem CID | 175203408 |
| Molecular Formula | C11H17F9OSi |
| Molecular Weight | 364.32 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | (4,5,5,6,6,7,8,9,9-nonafluoro-2,3-dimethylnonan-2-yl)oxysilane |
| SMILES | CC(C(F)C(F)(F)C(F)(F)C(F)C(F)C(F)F)C(C)(C)O[SiH3] |
| InChI | InChI=1S/C11H17F9OSi/c1-4(9(2,3)21-22)6(13)10(17,18)11(19,20)7(14)5(12)8(15)16/h4-8H,1-3,22H3 |
| InChIKey | JTMHSQVGOKMBGD-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.32 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|