C38H36F2N4O9PS2+ — CID 175203576
bis[4-[(1S)-1-[2-(6-fluoro-1H-indole-3-carbonyl)-1,3-thiazol-4-yl]propoxy]-4-oxobutoxy]-oxophosphanium (PubChem CID 175203576) has the molecular formula C38H36F2N4O9PS2+ and a molecular weight of 825.83 g/mol. Its IUPAC name is bis[4-[(1S)-1-[2-(6-fluoro-1H-indole-3-carbonyl)-1,3-thiazol-4-yl]propoxy]-4-oxobutoxy]-oxophosphanium.
| Compound Name | bis[4-[(1S)-1-[2-(6-fluoro-1H-indole-3-carbonyl)-1,3-thiazol-4-yl]propoxy]-4-oxobutoxy]-oxophosphanium |
|---|---|
| PubChem CID | 175203576 |
| Molecular Formula | C38H36F2N4O9PS2+ |
| Molecular Weight | 825.83 g/mol |
| Exact Mass | 825.16 |
| IUPAC Name | bis[4-[(1S)-1-[2-(6-fluoro-1H-indole-3-carbonyl)-1,3-thiazol-4-yl]propoxy]-4-oxobutoxy]-oxophosphanium |
| SMILES | CC[C@H](OC(=O)CCCO[P+](=O)OCCCC(=O)O[C@@H](CC)c1csc(C(=O)c2c[nH]c3cc(F)ccc23)n1)c1csc(C(=O)c2c[nH]c3cc(F)ccc23)n1 |
| InChI | InChI=1S/C38H35F2N4O9PS2/c1-3-31(29-19-55-37(43-29)35(47)25-17-41-27-15-21(39)9-11-23(25)27)52-33(45)7-5-13-50-54(49)51-14-6-8-34(46)53-32(4-2)30-20-56-38(44-30)36(48)26-18-42-28-16-22(40)10-12-24(26)28/h9-12,15-20,31-32H,3-8,13-14H2,1-2H3,(H-,41,42,47,48)/p+1/t31-,32-/m0/s1 |
| InChIKey | UPOSUDXOFUSLSD-ACHIHNKUSA-O |
| XLogP | 9.24 |
| TPSA | 179.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 825.83 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|