C17H18N4O — CID 175204721
3-benzyl-6,7,8,9-tetrahydro-5H-azepino[1,2-a]purin-11-one (PubChem CID 175204721) has the molecular formula C17H18N4O and a molecular weight of 294.36 g/mol. Its IUPAC name is 3-benzyl-6,7,8,9-tetrahydro-5H-azepino[1,2-a]purin-11-one.
| Compound Name | 3-benzyl-6,7,8,9-tetrahydro-5H-azepino[1,2-a]purin-11-one |
|---|---|
| PubChem CID | 175204721 |
| Molecular Formula | C17H18N4O |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 3-benzyl-6,7,8,9-tetrahydro-5H-azepino[1,2-a]purin-11-one |
| SMILES | O=c1c2ncn(Cc3ccccc3)c2nc2n1CCCCC2 |
| InChI | InChI=1S/C17H18N4O/c22-17-15-16(19-14-9-5-2-6-10-21(14)17)20(12-18-15)11-13-7-3-1-4-8-13/h1,3-4,7-8,12H,2,5-6,9-11H2 |
| InChIKey | HFAKHYKSSFZQOG-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 52.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |