C10H11F6NO — CID 175204752
1-(1,2,2,3,3,3-hexafluoropropyl)-4-isocyanatocyclohexane (PubChem CID 175204752) has the molecular formula C10H11F6NO and a molecular weight of 275.19 g/mol. Its IUPAC name is 1-(1,2,2,3,3,3-hexafluoropropyl)-4-isocyanatocyclohexane.
| Compound Name | 1-(1,2,2,3,3,3-hexafluoropropyl)-4-isocyanatocyclohexane |
|---|---|
| PubChem CID | 175204752 |
| Molecular Formula | C10H11F6NO |
| Molecular Weight | 275.19 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | 1-(1,2,2,3,3,3-hexafluoropropyl)-4-isocyanatocyclohexane |
| SMILES | O=C=NC1CCC(C(F)C(F)(F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C10H11F6NO/c11-8(9(12,13)10(14,15)16)6-1-3-7(4-2-6)17-5-18/h6-8H,1-4H2 |
| InChIKey | BFCVHSNGNALSPW-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.19 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|