C13H16N6OS — CID 175204770
N-[4-methyl-2-(2-piperazin-1-ylpyrimidin-5-yl)-1,3-thiazol-5-yl]formamide (PubChem CID 175204770) has the molecular formula C13H16N6OS and a molecular weight of 304.38 g/mol. Its IUPAC name is N-[4-methyl-2-(2-piperazin-1-ylpyrimidin-5-yl)-1,3-thiazol-5-yl]formamide.
| Compound Name | N-[4-methyl-2-(2-piperazin-1-ylpyrimidin-5-yl)-1,3-thiazol-5-yl]formamide |
|---|---|
| PubChem CID | 175204770 |
| Molecular Formula | C13H16N6OS |
| Molecular Weight | 304.38 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | N-[4-methyl-2-(2-piperazin-1-ylpyrimidin-5-yl)-1,3-thiazol-5-yl]formamide |
| SMILES | Cc1nc(-c2cnc(N3CCNCC3)nc2)sc1NC=O |
| InChI | InChI=1S/C13H16N6OS/c1-9-11(17-8-20)21-12(18-9)10-6-15-13(16-7-10)19-4-2-14-3-5-19/h6-8,14H,2-5H2,1H3,(H,17,20) |
| InChIKey | AVNWAQDIZVPNFK-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 83.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.38 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|