C12H11F5N4O2S — CID 175205999
3-ethylsulfonyl-2-(2,2,3,3,3-pentafluoropropyl)-6-(1,2,4-triazol-1-yl)pyridine (PubChem CID 175205999) has the molecular formula C12H11F5N4O2S and a molecular weight of 370.30 g/mol. Its IUPAC name is 3-ethylsulfonyl-2-(2,2,3,3,3-pentafluoropropyl)-6-(1,2,4-triazol-1-yl)pyridine.
| Compound Name | 3-ethylsulfonyl-2-(2,2,3,3,3-pentafluoropropyl)-6-(1,2,4-triazol-1-yl)pyridine |
|---|---|
| PubChem CID | 175205999 |
| Molecular Formula | C12H11F5N4O2S |
| Molecular Weight | 370.30 g/mol |
| Exact Mass | 370.05 |
| IUPAC Name | 3-ethylsulfonyl-2-(2,2,3,3,3-pentafluoropropyl)-6-(1,2,4-triazol-1-yl)pyridine |
| SMILES | CCS(=O)(=O)c1ccc(-n2cncn2)nc1CC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H11F5N4O2S/c1-2-24(22,23)9-3-4-10(21-7-18-6-19-21)20-8(9)5-11(13,14)12(15,16)17/h3-4,6-7H,2,5H2,1H3 |
| InChIKey | OALXMWYSDCMJOB-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 77.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.30 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|