About 3-(3,3-difluoroprop-2-enyl)-1,4-benzodiazepin-2-one
3-(3,3-difluoroprop-2-enyl)-1,4-benzodiazepin-2-one (PubChem CID 175206879) has the molecular formula C12H8F2N2O
and a molecular weight of 234.21 g/mol. Its IUPAC name is 3-(3,3-difluoroprop-2-enyl)-1,4-benzodiazepin-2-one.
Molecular Properties
| Compound Name | 3-(3,3-difluoroprop-2-enyl)-1,4-benzodiazepin-2-one |
| PubChem CID | 175206879 |
| Molecular Formula | C12H8F2N2O |
| Molecular Weight | 234.21 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | 3-(3,3-difluoroprop-2-enyl)-1,4-benzodiazepin-2-one |
| SMILES | O=c1nc2ccccc2cnc1CC=C(F)F |
| InChI | InChI=1S/C12H8F2N2O/c13-11(14)6-5-10-12(17)16-9-4-2-1-3-8(9)7-15-10/h1-4,6-7H,5H2 |
| InChIKey | FSHMOWPSYIBQIW-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.21 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(3,3-difluoroprop-2-enyl)-1,4-benzodiazepin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,3-difluoroprop-2-enyl)-1,4-benzodiazepin-2-one?
The IUPAC name of 3-(3,3-difluoroprop-2-enyl)-1,4-benzodiazepin-2-one (CID 175206879) is 3-(3,3-difluoroprop-2-enyl)-1,4-benzodiazepin-2-one.
What is the SMILES notation for 3-(3,3-difluoroprop-2-enyl)-1,4-benzodiazepin-2-one?
The canonical SMILES for 3-(3,3-difluoroprop-2-enyl)-1,4-benzodiazepin-2-one is O=c1nc2ccccc2cnc1CC=C(F)F.
What is the InChIKey of 3-(3,3-difluoroprop-2-enyl)-1,4-benzodiazepin-2-one?
The InChIKey is FSHMOWPSYIBQIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8F2N2O/c13-11(14)6-5-10-12(17)16-9-4-2-1-3-8(9)7-15-10/h1-4,6-7H,5H2.
What are the key properties of 3-(3,3-difluoroprop-2-enyl)-1,4-benzodiazepin-2-one?
3-(3,3-difluoroprop-2-enyl)-1,4-benzodiazepin-2-one has a molecular weight of 234.21 g/mol, XLogP of 2.31, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,3-difluoroprop-2-enyl)-1,4-benzodiazepin-2-one is sourced from PubChem (CID 175206879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).