About pentylperoxy nitrate
pentylperoxy nitrate (PubChem CID 175207218) has the molecular formula C5H11NO5
and a molecular weight of 165.14 g/mol. Its IUPAC name is pentylperoxy nitrate.
Molecular Properties
| Compound Name | pentylperoxy nitrate |
| PubChem CID | 175207218 |
| Molecular Formula | C5H11NO5 |
| Molecular Weight | 165.14 g/mol |
| Exact Mass | 165.06 |
| IUPAC Name | pentylperoxy nitrate |
| SMILES | CCCCCOOO[N+](=O)[O-] |
| InChI | InChI=1S/C5H11NO5/c1-2-3-4-5-9-11-10-6(7)8/h2-5H2,1H3 |
| InChIKey | OXJBQUMKEWATGG-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.14 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze pentylperoxy nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentylperoxy nitrate?
The IUPAC name of pentylperoxy nitrate (CID 175207218) is pentylperoxy nitrate.
What is the SMILES notation for pentylperoxy nitrate?
The canonical SMILES for pentylperoxy nitrate is CCCCCOOO[N+](=O)[O-].
What is the InChIKey of pentylperoxy nitrate?
The InChIKey is OXJBQUMKEWATGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO5/c1-2-3-4-5-9-11-10-6(7)8/h2-5H2,1H3.
What are the key properties of pentylperoxy nitrate?
pentylperoxy nitrate has a molecular weight of 165.14 g/mol, XLogP of 1.25, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for pentylperoxy nitrate is sourced from PubChem (CID 175207218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).