C23H18Cl2F2N2O2 — CID 175207478
6-(4-amino-2,6-dichlorophenoxy)-2-[(3,5-difluorophenyl)methyl]-3,4-dihydro-1H-isoquinoline-1-carbaldehyde (PubChem CID 175207478) has the molecular formula C23H18Cl2F2N2O2 and a molecular weight of 463.31 g/mol. Its IUPAC name is 6-(4-amino-2,6-dichlorophenoxy)-2-[(3,5-difluorophenyl)methyl]-3,4-dihydro-1H-isoquinoline-1-carbaldehyde.
| Compound Name | 6-(4-amino-2,6-dichlorophenoxy)-2-[(3,5-difluorophenyl)methyl]-3,4-dihydro-1H-isoquinoline-1-carbaldehyde |
|---|---|
| PubChem CID | 175207478 |
| Molecular Formula | C23H18Cl2F2N2O2 |
| Molecular Weight | 463.31 g/mol |
| Exact Mass | 462.07 |
| IUPAC Name | 6-(4-amino-2,6-dichlorophenoxy)-2-[(3,5-difluorophenyl)methyl]-3,4-dihydro-1H-isoquinoline-1-carbaldehyde |
| SMILES | Nc1cc(Cl)c(Oc2ccc3c(c2)CCN(Cc2cc(F)cc(F)c2)C3C=O)c(Cl)c1 |
| InChI | InChI=1S/C23H18Cl2F2N2O2/c24-20-9-17(28)10-21(25)23(20)31-18-1-2-19-14(7-18)3-4-29(22(19)12-30)11-13-5-15(26)8-16(27)6-13/h1-2,5-10,12,22H,3-4,11,28H2 |
| InChIKey | XZZKOJOGDIUBMN-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.31 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|