About 2-[(1,3-dimethyl-5-prop-2-ynoxypyrazole-4-carbonyl)amino]-4-methylsulfanylbutanoic acid
2-[(1,3-dimethyl-5-prop-2-ynoxypyrazole-4-carbonyl)amino]-4-methylsulfanylbutanoic acid (PubChem CID 175207920) has the molecular formula C14H19N3O4S
and a molecular weight of 325.39 g/mol. Its IUPAC name is 2-[(1,3-dimethyl-5-prop-2-ynoxypyrazole-4-carbonyl)amino]-4-methylsulfanylbutanoic acid.
Molecular Properties
| Compound Name | 2-[(1,3-dimethyl-5-prop-2-ynoxypyrazole-4-carbonyl)amino]-4-methylsulfanylbutanoic acid |
| PubChem CID | 175207920 |
| Molecular Formula | C14H19N3O4S |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | 2-[(1,3-dimethyl-5-prop-2-ynoxypyrazole-4-carbonyl)amino]-4-methylsulfanylbutanoic acid |
| SMILES | C#CCOc1c(C(=O)NC(CCSC)C(=O)O)c(C)nn1C |
| InChI | InChI=1S/C14H19N3O4S/c1-5-7-21-13-11(9(2)16-17(13)3)12(18)15-10(14(19)20)6-8-22-4/h1,10H,6-8H2,2-4H3,(H,15,18)(H,19,20) |
| InChIKey | JUAYDYGFDBUCPK-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1,3-dimethyl-5-prop-2-ynoxypyrazole-4-carbonyl)amino]-4-methylsulfanylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1,3-dimethyl-5-prop-2-ynoxypyrazole-4-carbonyl)amino]-4-methylsulfanylbutanoic acid?
The IUPAC name of 2-[(1,3-dimethyl-5-prop-2-ynoxypyrazole-4-carbonyl)amino]-4-methylsulfanylbutanoic acid (CID 175207920) is 2-[(1,3-dimethyl-5-prop-2-ynoxypyrazole-4-carbonyl)amino]-4-methylsulfanylbutanoic acid.
What is the SMILES notation for 2-[(1,3-dimethyl-5-prop-2-ynoxypyrazole-4-carbonyl)amino]-4-methylsulfanylbutanoic acid?
The canonical SMILES for 2-[(1,3-dimethyl-5-prop-2-ynoxypyrazole-4-carbonyl)amino]-4-methylsulfanylbutanoic acid is C#CCOc1c(C(=O)NC(CCSC)C(=O)O)c(C)nn1C.
What is the InChIKey of 2-[(1,3-dimethyl-5-prop-2-ynoxypyrazole-4-carbonyl)amino]-4-methylsulfanylbutanoic acid?
The InChIKey is JUAYDYGFDBUCPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N3O4S/c1-5-7-21-13-11(9(2)16-17(13)3)12(18)15-10(14(19)20)6-8-22-4/h1,10H,6-8H2,2-4H3,(H,15,18)(H,19,20).
What are the key properties of 2-[(1,3-dimethyl-5-prop-2-ynoxypyrazole-4-carbonyl)amino]-4-methylsulfanylbutanoic acid?
2-[(1,3-dimethyl-5-prop-2-ynoxypyrazole-4-carbonyl)amino]-4-methylsulfanylbutanoic acid has a molecular weight of 325.39 g/mol, XLogP of 0.68, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1,3-dimethyl-5-prop-2-ynoxypyrazole-4-carbonyl)amino]-4-methylsulfanylbutanoic acid is sourced from PubChem (CID 175207920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).