C13H25NO6Si — CID 175208194
(2S,4S)-4-(1-dimethylsilyloxy-2,2-dimethylpropyl)-4-hydroxypyrrolidine-1,2-dicarboxylic acid (PubChem CID 175208194) has the molecular formula C13H25NO6Si and a molecular weight of 319.43 g/mol. Its IUPAC name is (2S,4S)-4-(1-dimethylsilyloxy-2,2-dimethylpropyl)-4-hydroxypyrrolidine-1,2-dicarboxylic acid.
| Compound Name | (2S,4S)-4-(1-dimethylsilyloxy-2,2-dimethylpropyl)-4-hydroxypyrrolidine-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 175208194 |
| Molecular Formula | C13H25NO6Si |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | (2S,4S)-4-(1-dimethylsilyloxy-2,2-dimethylpropyl)-4-hydroxypyrrolidine-1,2-dicarboxylic acid |
| SMILES | C[SiH](C)OC(C(C)(C)C)[C@]1(O)C[C@@H](C(=O)O)N(C(=O)O)C1 |
| InChI | InChI=1S/C13H25NO6Si/c1-12(2,3)10(20-21(4)5)13(19)6-8(9(15)16)14(7-13)11(17)18/h8,10,19,21H,6-7H2,1-5H3,(H,15,16)(H,17,18)/t8-,10?,13-/m0/s1 |
| InChIKey | URZSMUNMGSXVQI-PPVWGBJPSA-N |
| XLogP | 0.97 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|