C15H25F2N3O2 — CID 175208342
prop-2-enyl 4-(6,6-difluoro-2-methyl-3a,4,5,6a-tetrahydro-3H-pyrrolo[3,2-c]pyrazol-1-yl)-2,2-dimethylbutanoate (PubChem CID 175208342) has the molecular formula C15H25F2N3O2 and a molecular weight of 317.38 g/mol. Its IUPAC name is prop-2-enyl 4-(6,6-difluoro-2-methyl-3a,4,5,6a-tetrahydro-3H-pyrrolo[3,2-c]pyrazol-1-yl)-2,2-dimethylbutanoate.
| Compound Name | prop-2-enyl 4-(6,6-difluoro-2-methyl-3a,4,5,6a-tetrahydro-3H-pyrrolo[3,2-c]pyrazol-1-yl)-2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 175208342 |
| Molecular Formula | C15H25F2N3O2 |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.19 |
| IUPAC Name | prop-2-enyl 4-(6,6-difluoro-2-methyl-3a,4,5,6a-tetrahydro-3H-pyrrolo[3,2-c]pyrazol-1-yl)-2,2-dimethylbutanoate |
| SMILES | C=CCOC(=O)C(C)(C)CCN1C2C(CN1C)NCC2(F)F |
| InChI | InChI=1S/C15H25F2N3O2/c1-5-8-22-13(21)14(2,3)6-7-20-12-11(9-19(20)4)18-10-15(12,16)17/h5,11-12,18H,1,6-10H2,2-4H3 |
| InChIKey | VPIZOBSPCYRLBN-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|