About 1-fluorooctyl nonanoate
1-fluorooctyl nonanoate (PubChem CID 175208382) has the molecular formula C17H33FO2
and a molecular weight of 288.45 g/mol. Its IUPAC name is 1-fluorooctyl nonanoate.
Molecular Properties
| Compound Name | 1-fluorooctyl nonanoate |
| PubChem CID | 175208382 |
| Molecular Formula | C17H33FO2 |
| Molecular Weight | 288.45 g/mol |
| Exact Mass | 288.25 |
| IUPAC Name | 1-fluorooctyl nonanoate |
| SMILES | CCCCCCCCC(=O)OC(F)CCCCCCC |
| InChI | InChI=1S/C17H33FO2/c1-3-5-7-9-11-13-15-17(19)20-16(18)14-12-10-8-6-4-2/h16H,3-15H2,1-2H3 |
| InChIKey | SYFXVFLKSPPZRR-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 288.45 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-fluorooctyl nonanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluorooctyl nonanoate?
The IUPAC name of 1-fluorooctyl nonanoate (CID 175208382) is 1-fluorooctyl nonanoate.
What is the SMILES notation for 1-fluorooctyl nonanoate?
The canonical SMILES for 1-fluorooctyl nonanoate is CCCCCCCCC(=O)OC(F)CCCCCCC.
What is the InChIKey of 1-fluorooctyl nonanoate?
The InChIKey is SYFXVFLKSPPZRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H33FO2/c1-3-5-7-9-11-13-15-17(19)20-16(18)14-12-10-8-6-4-2/h16H,3-15H2,1-2H3.
What are the key properties of 1-fluorooctyl nonanoate?
1-fluorooctyl nonanoate has a molecular weight of 288.45 g/mol, XLogP of 5.94, 14 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluorooctyl nonanoate is sourced from PubChem (CID 175208382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).