C42H88N2 — CID 175208767
N,N-dioctyloctan-1-amine;(Z)-octadec-9-en-1-amine (PubChem CID 175208767) has the molecular formula C42H88N2 and a molecular weight of 621.18 g/mol. Its IUPAC name is N,N-dioctyloctan-1-amine;(Z)-octadec-9-en-1-amine.
| Compound Name | N,N-dioctyloctan-1-amine;(Z)-octadec-9-en-1-amine |
|---|---|
| PubChem CID | 175208767 |
| Molecular Formula | C42H88N2 |
| Molecular Weight | 621.18 g/mol |
| Exact Mass | 620.69 |
| IUPAC Name | N,N-dioctyloctan-1-amine;(Z)-octadec-9-en-1-amine |
| SMILES | CCCCCCCC/C=C\CCCCCCCCN.CCCCCCCCN(CCCCCCCC)CCCCCCCC |
| InChI | InChI=1S/C24H51N.C18H37N/c1-4-7-10-13-16-19-22-25(23-20-17-14-11-8-5-2)24-21-18-15-12-9-6-3;1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19/h4-24H2,1-3H3;9-10H,2-8,11-19H2,1H3/b;10-9- |
| InChIKey | SMLLTFKLXCBWCI-SVMKZPJVSA-N |
| XLogP | 14.35 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.18 |
| LogP ≤ 5 | 14.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|