C17H14FN3O3S — CID 175208908
4-[4-(4-fluoro-3,5-dimethylphenyl)-1,3,5-triazin-2-yl]benzenesulfonic acid (PubChem CID 175208908) has the molecular formula C17H14FN3O3S and a molecular weight of 359.38 g/mol. Its IUPAC name is 4-[4-(4-fluoro-3,5-dimethylphenyl)-1,3,5-triazin-2-yl]benzenesulfonic acid.
| Compound Name | 4-[4-(4-fluoro-3,5-dimethylphenyl)-1,3,5-triazin-2-yl]benzenesulfonic acid |
|---|---|
| PubChem CID | 175208908 |
| Molecular Formula | C17H14FN3O3S |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | 4-[4-(4-fluoro-3,5-dimethylphenyl)-1,3,5-triazin-2-yl]benzenesulfonic acid |
| SMILES | Cc1cc(-c2ncnc(-c3ccc(S(=O)(=O)O)cc3)n2)cc(C)c1F |
| InChI | InChI=1S/C17H14FN3O3S/c1-10-7-13(8-11(2)15(10)18)17-20-9-19-16(21-17)12-3-5-14(6-4-12)25(22,23)24/h3-9H,1-2H3,(H,22,23,24) |
| InChIKey | GMJQZRAASUKXNS-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 93.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|