C18H12F3NO4S — CID 175209910
2-[4-(benzenesulfonyl)-3,4,4-trifluorobut-2-enyl]isoindole-1,3-dione (PubChem CID 175209910) has the molecular formula C18H12F3NO4S and a molecular weight of 395.36 g/mol. Its IUPAC name is 2-[4-(benzenesulfonyl)-3,4,4-trifluorobut-2-enyl]isoindole-1,3-dione.
| Compound Name | 2-[4-(benzenesulfonyl)-3,4,4-trifluorobut-2-enyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 175209910 |
| Molecular Formula | C18H12F3NO4S |
| Molecular Weight | 395.36 g/mol |
| Exact Mass | 395.04 |
| IUPAC Name | 2-[4-(benzenesulfonyl)-3,4,4-trifluorobut-2-enyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CC=C(F)C(F)(F)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H12F3NO4S/c19-15(18(20,21)27(25,26)12-6-2-1-3-7-12)10-11-22-16(23)13-8-4-5-9-14(13)17(22)24/h1-10H,11H2 |
| InChIKey | VVJLCTASDYDKOA-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.36 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|