About 3-imino-2,2-dimethyloctanedioic acid
3-imino-2,2-dimethyloctanedioic acid (PubChem CID 175210216) has the molecular formula C10H17NO4
and a molecular weight of 215.25 g/mol. Its IUPAC name is 3-imino-2,2-dimethyloctanedioic acid.
Molecular Properties
| Compound Name | 3-imino-2,2-dimethyloctanedioic acid |
| PubChem CID | 175210216 |
| Molecular Formula | C10H17NO4 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | 3-imino-2,2-dimethyloctanedioic acid |
| SMILES | [H]/N=C(\CCCCC(=O)O)C(C)(C)C(=O)O |
| InChI | InChI=1S/C10H17NO4/c1-10(2,9(14)15)7(11)5-3-4-6-8(12)13/h11H,3-6H2,1-2H3,(H,12,13)(H,14,15)/b11-7+ |
| InChIKey | QQTIYFFIPNFMAK-YRNVUSSQSA-N |
| XLogP | 1.76 |
| TPSA | 98.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-imino-2,2-dimethyloctanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-imino-2,2-dimethyloctanedioic acid?
The IUPAC name of 3-imino-2,2-dimethyloctanedioic acid (CID 175210216) is 3-imino-2,2-dimethyloctanedioic acid.
What is the SMILES notation for 3-imino-2,2-dimethyloctanedioic acid?
The canonical SMILES for 3-imino-2,2-dimethyloctanedioic acid is [H]/N=C(\CCCCC(=O)O)C(C)(C)C(=O)O.
What is the InChIKey of 3-imino-2,2-dimethyloctanedioic acid?
The InChIKey is QQTIYFFIPNFMAK-YRNVUSSQSA-N. The full InChI is InChI=1S/C10H17NO4/c1-10(2,9(14)15)7(11)5-3-4-6-8(12)13/h11H,3-6H2,1-2H3,(H,12,13)(H,14,15)/b11-7+.
What are the key properties of 3-imino-2,2-dimethyloctanedioic acid?
3-imino-2,2-dimethyloctanedioic acid has a molecular weight of 215.25 g/mol, XLogP of 1.76, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-imino-2,2-dimethyloctanedioic acid is sourced from PubChem (CID 175210216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).