C45H71NO6 — CID 175210461
2-[4-[2-(3-tert-butyl-4-hydroxyphenyl)-4,4-dimethylpentanoyl]oxy-2,2,6,6-tetramethylpiperidin-1-yl]ethyl 2-(3-tert-butyl-4-hydroxyphenyl)-4,4-dimethylpentanoate (PubChem CID 175210461) has the molecular formula C45H71NO6 and a molecular weight of 722.06 g/mol. Its IUPAC name is 2-[4-[2-(3-tert-butyl-4-hydroxyphenyl)-4,4-dimethylpentanoyl]oxy-2,2,6,6-tetramethylpiperidin-1-yl]ethyl 2-(3-tert-butyl-4-hydroxyphenyl)-4,4-dimethylpentanoate.
| Compound Name | 2-[4-[2-(3-tert-butyl-4-hydroxyphenyl)-4,4-dimethylpentanoyl]oxy-2,2,6,6-tetramethylpiperidin-1-yl]ethyl 2-(3-tert-butyl-4-hydroxyphenyl)-4,4-dimethylpentanoate |
|---|---|
| PubChem CID | 175210461 |
| Molecular Formula | C45H71NO6 |
| Molecular Weight | 722.06 g/mol |
| Exact Mass | 721.53 |
| IUPAC Name | 2-[4-[2-(3-tert-butyl-4-hydroxyphenyl)-4,4-dimethylpentanoyl]oxy-2,2,6,6-tetramethylpiperidin-1-yl]ethyl 2-(3-tert-butyl-4-hydroxyphenyl)-4,4-dimethylpentanoate |
| SMILES | CC(C)(C)CC(C(=O)OCCN1C(C)(C)CC(OC(=O)C(CC(C)(C)C)c2ccc(O)c(C(C)(C)C)c2)CC1(C)C)c1ccc(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C45H71NO6/c1-40(2,3)27-32(29-17-19-36(47)34(23-29)42(7,8)9)38(49)51-22-21-46-44(13,14)25-31(26-45(46,15)16)52-39(50)33(28-41(4,5)6)30-18-20-37(48)35(24-30)43(10,11)12/h17-20,23-24,31-33,47-48H,21-22,25-28H2,1-16H3 |
| InChIKey | SGEBHLQAUPMKMA-UHFFFAOYSA-N |
| XLogP | 10.54 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.06 |
| LogP ≤ 5 | 10.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |