About dioxotungsten;octane;1H-pyridin-2-one
dioxotungsten;octane;1H-pyridin-2-one (PubChem CID 175210750) has the molecular formula C13H23NO3W
and a molecular weight of 425.17 g/mol. Its IUPAC name is dioxotungsten;octane;1H-pyridin-2-one.
Molecular Properties
| Compound Name | dioxotungsten;octane;1H-pyridin-2-one |
| PubChem CID | 175210750 |
| Molecular Formula | C13H23NO3W |
| Molecular Weight | 425.17 g/mol |
| Exact Mass | 425.12 |
| IUPAC Name | dioxotungsten;octane;1H-pyridin-2-one |
| SMILES | CCCCCCCC.O=[W]=O.O=c1cccc[nH]1 |
| InChI | InChI=1S/C8H18.C5H5NO.2O.W/c1-3-5-7-8-6-4-2;7-5-3-1-2-4-6-5;;;/h3-8H2,1-2H3;1-4H,(H,6,7);;; |
| InChIKey | SGCMZXVWDGIKCB-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 67.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 425.17 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze dioxotungsten;octane;1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dioxotungsten;octane;1H-pyridin-2-one?
The IUPAC name of dioxotungsten;octane;1H-pyridin-2-one (CID 175210750) is dioxotungsten;octane;1H-pyridin-2-one.
What is the SMILES notation for dioxotungsten;octane;1H-pyridin-2-one?
The canonical SMILES for dioxotungsten;octane;1H-pyridin-2-one is CCCCCCCC.O=[W]=O.O=c1cccc[nH]1.
What is the InChIKey of dioxotungsten;octane;1H-pyridin-2-one?
The InChIKey is SGCMZXVWDGIKCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18.C5H5NO.2O.W/c1-3-5-7-8-6-4-2;7-5-3-1-2-4-6-5;;;/h3-8H2,1-2H3;1-4H,(H,6,7);;;.
What are the key properties of dioxotungsten;octane;1H-pyridin-2-one?
dioxotungsten;octane;1H-pyridin-2-one has a molecular weight of 425.17 g/mol, XLogP of 3.50, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dioxotungsten;octane;1H-pyridin-2-one is sourced from PubChem (CID 175210750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).