C22H23F3N6O3S — CID 175211331
ethyl 6-[(6,6-difluoro-3,3a,5,6a-tetrahydro-1H-pyrrolo[3,2-c][1,2]oxazol-4-yl)methyl]-4-(6-fluoro-2-methyl-3-pyridinyl)-2-(1,3-thiazol-2-yl)-1,4-dihydropyrimidine-5-carboxylate (PubChem CID 175211331) has the molecular formula C22H23F3N6O3S and a molecular weight of 508.53 g/mol. Its IUPAC name is ethyl 6-[(6,6-difluoro-3,3a,5,6a-tetrahydro-1H-pyrrolo[3,2-c][1,2]oxazol-4-yl)methyl]-4-(6-fluoro-2-methyl-3-pyridinyl)-2-(1,3-thiazol-2-yl)-1,4-dihydropyrimidine-5-carboxylate.
| Compound Name | ethyl 6-[(6,6-difluoro-3,3a,5,6a-tetrahydro-1H-pyrrolo[3,2-c][1,2]oxazol-4-yl)methyl]-4-(6-fluoro-2-methyl-3-pyridinyl)-2-(1,3-thiazol-2-yl)-1,4-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 175211331 |
| Molecular Formula | C22H23F3N6O3S |
| Molecular Weight | 508.53 g/mol |
| Exact Mass | 508.15 |
| IUPAC Name | ethyl 6-[(6,6-difluoro-3,3a,5,6a-tetrahydro-1H-pyrrolo[3,2-c][1,2]oxazol-4-yl)methyl]-4-(6-fluoro-2-methyl-3-pyridinyl)-2-(1,3-thiazol-2-yl)-1,4-dihydropyrimidine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(CN2CC(F)(F)C3NOCC32)NC(c2nccs2)=NC1c1ccc(F)nc1C |
| InChI | InChI=1S/C22H23F3N6O3S/c1-3-33-21(32)16-13(8-31-10-22(24,25)18-14(31)9-34-30-18)28-19(20-26-6-7-35-20)29-17(16)12-4-5-15(23)27-11(12)2/h4-7,14,17-18,30H,3,8-10H2,1-2H3,(H,28,29) |
| InChIKey | RDGGIXFBOPQVLS-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 100.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.53 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|