C15H27F7OSi — CID 175211415
(5,6,7,8,9,10,13-heptafluoro-2,3-dimethyltridecan-2-yl)oxysilane (PubChem CID 175211415) has the molecular formula C15H27F7OSi and a molecular weight of 384.45 g/mol. Its IUPAC name is (5,6,7,8,9,10,13-heptafluoro-2,3-dimethyltridecan-2-yl)oxysilane.
| Compound Name | (5,6,7,8,9,10,13-heptafluoro-2,3-dimethyltridecan-2-yl)oxysilane |
|---|---|
| PubChem CID | 175211415 |
| Molecular Formula | C15H27F7OSi |
| Molecular Weight | 384.45 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | (5,6,7,8,9,10,13-heptafluoro-2,3-dimethyltridecan-2-yl)oxysilane |
| SMILES | CC(CC(F)C(F)C(F)C(F)C(F)C(F)CCCF)C(C)(C)O[SiH3] |
| InChI | InChI=1S/C15H27F7OSi/c1-8(15(2,3)23-24)7-10(18)12(20)14(22)13(21)11(19)9(17)5-4-6-16/h8-14H,4-7H2,1-3,24H3 |
| InChIKey | QRAPDDMZAFCIEZ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.45 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|